ChemNet > CAS > 2497-91-8 2-Chloro-3,5-dinitrobenzoic acid
2497-91-8 2-Chloro-3,5-dinitrobenzoic acid
| product Name |
2-Chloro-3,5-dinitrobenzoic acid |
| Synonyms |
2-C-3,5-DNBA; 2-chloro-3,5-dinitrobenzoate |
| Molecular Formula |
C7H2ClN2O6 |
| Molecular Weight |
245.5541 |
| InChI |
InChI=1/C7H3ClN2O6/c8-6-4(7(11)12)1-3(9(13)14)2-5(6)10(15)16/h1-2H,(H,11,12)/p-1 |
| CAS Registry Number |
2497-91-8 |
| EINECS |
219-684-9 |
| Molecular Structure |
|
| Melting point |
196-199℃ |
| Boiling point |
408.3°C at 760 mmHg |
| Flash point |
200.8°C |
| Vapour Pressur |
2.12E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
