ChemNet > CAS > 2905-60-4;25134-08-1 2,3-Dichlorobenzoyl Chloride
2905-60-4;25134-08-1 2,3-Dichlorobenzoyl Chloride
| product Name |
2,3-Dichlorobenzoyl Chloride |
| Synonyms |
2,3-Dichloro benzoic acid; dichlorobenzoyl chloride; Benzoyl chloride, dichloro-; Benzoyl chloride, 2,3-dichloro-; 2,3-Dichlorobenzoylchloride; 2,3-Dichloro benzoic Chloride |
| Molecular Formula |
C7H3Cl3O |
| Molecular Weight |
209.46 |
| InChI |
InChI=1/C7H3Cl3O/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H |
| CAS Registry Number |
2905-60-4;25134-08-1 |
| EINECS |
220-811-5 |
| Molecular Structure |
|
| Density |
14014 |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
