ChemNet > CAS > 2523-42-4 2-Iodofluorene
2523-42-4 2-Iodofluorene
| product Name |
2-Iodofluorene |
| Synonyms |
Iodofluorene; 2-Iodo-9H-fluorene; 2-Iodo-9H-fluorene, 90+% |
| Molecular Formula |
C13H9I |
| Molecular Weight |
292.115 |
| InChI |
InChI=1/C13H9I/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8H,7H2 |
| CAS Registry Number |
2523-42-4 |
| Molecular Structure |
|
| Density |
1.714g/cm3 |
| Melting point |
126-129℃ |
| Boiling point |
375.6°C at 760 mmHg |
| Refractive index |
1.711 |
| Flash point |
170.6°C |
| Vapour Pressur |
1.66E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
