ChemNet > CAS > 27311-63-3 1-isoquinolinylmethanol
27311-63-3 1-isoquinolinylmethanol
| product Name |
1-isoquinolinylmethanol |
| Synonyms |
isoquinolin-1-ylmethanol |
| Molecular Formula |
C10H9NO |
| Molecular Weight |
159.1846 |
| InChI |
InChI=1/C10H9NO/c12-7-10-9-4-2-1-3-8(9)5-6-11-10/h1-6,12H,7H2 |
| CAS Registry Number |
27311-63-3 |
| Molecular Structure |
|
| Density |
1.218g/cm3 |
| Melting point |
80℃ |
| Boiling point |
335.1°C at 760 mmHg |
| Refractive index |
1.667 |
| Flash point |
156.5°C |
| Vapour Pressur |
4.82E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
