ChemNet > CAS > 29338-49-6 1,1-Diphenyl-2-propanol
29338-49-6 1,1-Diphenyl-2-propanol
product Name |
1,1-Diphenyl-2-propanol |
Synonyms |
alpha-Methyl-beta-phenylphenethyl alcohol; 1,1-diphenylpropan-2-ol; (2S)-1,1-diphenylpropan-2-ol; (2R)-1,1-diphenylpropan-2-ol |
Molecular Formula |
C15H16O |
Molecular Weight |
212.2869 |
InChI |
InChI=1/C15H16O/c1-12(16)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12,15-16H,1H3/t12-/m1/s1 |
CAS Registry Number |
29338-49-6 |
EINECS |
249-574-6 |
Molecular Structure |
|
Density |
1.058g/cm3 |
Melting point |
59-63℃ |
Boiling point |
329°C at 760 mmHg |
Refractive index |
1.575 |
Flash point |
135.3°C |
Vapour Pressur |
7.36E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|