ChemNet > CAS > 29886-62-2 4-(2-thienyl)benzoic acid
29886-62-2 4-(2-thienyl)benzoic acid
| product Name |
4-(2-thienyl)benzoic acid |
| Synonyms |
4-(thiophen-2-yl)benzoic acid; 4-thiophen-2-ylbenzoate |
| Molecular Formula |
C11H7O2S |
| Molecular Weight |
203.2376 |
| InChI |
InChI=1/C11H8O2S/c12-11(13)9-5-3-8(4-6-9)10-2-1-7-14-10/h1-7H,(H,12,13)/p-1 |
| CAS Registry Number |
29886-62-2 |
| Molecular Structure |
|
| Melting point |
243℃ |
| Boiling point |
372.8°C at 760 mmHg |
| Flash point |
179.3°C |
| Vapour Pressur |
3.23E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
