ChemNet > CAS > 29927-08-0 2-Amino-5,6-dimethylbenzothiazole
29927-08-0 2-Amino-5,6-dimethylbenzothiazole
| product Name |
2-Amino-5,6-dimethylbenzothiazole |
| Synonyms |
5,6-dimethylbenzothiazol-2-ylamine; 5,6-dimethyl-1,3-benzothiazol-2-amine; 2-benzothiazolamine, 5,6-dimethyl-; 2-Amino-5,6-dimethyl-1,3-benzothiazol |
| Molecular Formula |
C9H10N2S |
| Molecular Weight |
178.2541 |
| InChI |
InChI=1/C9H10N2S/c1-5-3-7-8(4-6(5)2)12-9(10)11-7/h3-4H,1-2H3,(H2,10,11) |
| CAS Registry Number |
29927-08-0 |
| EINECS |
249-960-4 |
| Molecular Structure |
|
| Density |
1.263g/cm3 |
| Melting point |
185-189℃ |
| Boiling point |
342.1°C at 760 mmHg |
| Refractive index |
1.698 |
| Flash point |
160.7°C |
| Vapour Pressur |
7.68E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
