ChemNet > CAS > 29927-08-0 2-Amino-5,6-dimethylbenzothiazole
29927-08-0 2-Amino-5,6-dimethylbenzothiazole
product Name |
2-Amino-5,6-dimethylbenzothiazole |
Synonyms |
5,6-dimethylbenzothiazol-2-ylamine; 5,6-dimethyl-1,3-benzothiazol-2-amine; 2-benzothiazolamine, 5,6-dimethyl-; 2-Amino-5,6-dimethyl-1,3-benzothiazol |
Molecular Formula |
C9H10N2S |
Molecular Weight |
178.2541 |
InChI |
InChI=1/C9H10N2S/c1-5-3-7-8(4-6(5)2)12-9(10)11-7/h3-4H,1-2H3,(H2,10,11) |
CAS Registry Number |
29927-08-0 |
EINECS |
249-960-4 |
Molecular Structure |
|
Density |
1.263g/cm3 |
Melting point |
185-189℃ |
Boiling point |
342.1°C at 760 mmHg |
Refractive index |
1.698 |
Flash point |
160.7°C |
Vapour Pressur |
7.68E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|