ChemNet > CAS > 30595-79-0 2,6-Dichlorophenethylalcohol
30595-79-0 2,6-Dichlorophenethylalcohol
product Name |
2,6-Dichlorophenethylalcohol |
Synonyms |
2-(2,6-dichlorophenyl)ethanol |
Molecular Formula |
C8H8Cl2O |
Molecular Weight |
191.0545 |
InChI |
InChI=1/C8H8Cl2O/c9-7-2-1-3-8(10)6(7)4-5-11/h1-3,11H,4-5H2 |
CAS Registry Number |
30595-79-0 |
Molecular Structure |
|
Density |
1.329g/cm3 |
Melting point |
59℃ |
Boiling point |
276.6°C at 760 mmHg |
Refractive index |
1.569 |
Flash point |
117.2°C |
Vapour Pressur |
0.00229mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|