ChemNet > CAS > 3084-53-5 Trimethylsulfoniumbromide
3084-53-5 Trimethylsulfoniumbromide
| product Name |
Trimethylsulfoniumbromide |
| Synonyms |
Trimethylsulfonium bromide; Trimethylsulphonium bromide; trimethylsulfonium; Trimethyl-sulfoniubromide; Sulfonium, trimethyl-, bromide |
| Molecular Formula |
C3H9BrS |
| Molecular Weight |
157.0726 |
| InChI |
InChI=1/C3H9S.BrH/c1-4(2)3;/h1-3H3;1H/q+1;/p-1 |
| CAS Registry Number |
3084-53-5 |
| Molecular Structure |
|
| Melting point |
203℃ |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
