ChemNet > CAS > 3113-72-2 5-methyl-2-nitrobenzoic acid
3113-72-2 5-methyl-2-nitrobenzoic acid
product Name |
5-methyl-2-nitrobenzoic acid |
Synonyms |
6-Nitro-m-toluic acid; 2-Nitro-5-Methylbenzoicacid; 2-Nitro-5-methylbenzoic acid |
Molecular Formula |
C8H7NO4 |
Molecular Weight |
181.1455 |
InChI |
InChI=1/C8H7NO4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2-4H,1H3,(H,10,11) |
CAS Registry Number |
3113-72-2 |
EINECS |
221-481-5 |
Molecular Structure |
|
Density |
1.392g/cm3 |
Melting point |
134-136℃ |
Boiling point |
367.6°C at 760 mmHg |
Refractive index |
1.6 |
Flash point |
166.8°C |
Vapour Pressur |
4.72E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|