ChemNet > CAS > 31366-25-3 Tetrathiafulvalene
31366-25-3 Tetrathiafulvalene
| product Name |
Tetrathiafulvalene |
| Synonyms |
delta2,2-Bi-1,3-dithiole; TTF; TetrathiafulvaleneTTForangextl; delta-2:2-bis(1,3-dithiazole); DELTA^2^,^2^-Bi-1,3-dithiole~TTF; 2-(1,3-dithiol-2-ylidene)-1,3-dithiole |
| Molecular Formula |
C6H4S4 |
| Molecular Weight |
204.356 |
| InChI |
InChI=1/C6H4S4/c1-2-8-5(7-1)6-9-3-4-10-6/h1-4H |
| CAS Registry Number |
31366-25-3 |
| EINECS |
250-593-7 |
| Molecular Structure |
|
| Density |
1.636g/cm3 |
| Melting point |
117-120℃ |
| Boiling point |
229°C at 760 mmHg |
| Refractive index |
1.879 |
| Flash point |
120.9°C |
| Vapour Pressur |
0.107mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
