ChemNet > CAS > 3209-72-1 ethyl 5-methylisoxazole-3-carboxylate
3209-72-1 ethyl 5-methylisoxazole-3-carboxylate
product Name |
ethyl 5-methylisoxazole-3-carboxylate |
Synonyms |
5-methylisoxazole-3-carboxylate ethyl; ethyl 5-methyl-1,2-oxazole-3-carboxylate |
Molecular Formula |
C7H9NO3 |
Molecular Weight |
155.1513 |
InChI |
InChI=1/C7H9NO3/c1-3-10-7(9)6-4-5(2)11-8-6/h4H,3H2,1-2H3 |
CAS Registry Number |
3209-72-1 |
EINECS |
221-720-3 |
Molecular Structure |
|
Density |
1.139g/cm3 |
Melting point |
25℃ |
Boiling point |
246.2°C at 760 mmHg |
Refractive index |
1.468 |
Flash point |
102.7°C |
Vapour Pressur |
0.0275mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|