ChemNet > CAS > 32852-81-6 3-Phenoxyphenylacetic acid
32852-81-6 3-Phenoxyphenylacetic acid
| product Name |
3-Phenoxyphenylacetic acid |
| Synonyms |
3-Phenoxyphenylacetic |
| Molecular Formula |
C14H12O3 |
| Molecular Weight |
228.2433 |
| InChI |
InChI=1/C14H12O3/c15-14(16)10-11-5-4-8-13(9-11)17-12-6-2-1-3-7-12/h1-9H,10H2,(H,15,16) |
| CAS Registry Number |
32852-81-6 |
| Molecular Structure |
|
| Density |
1.217g/cm3 |
| Boiling point |
385.4°C at 760 mmHg |
| Refractive index |
1.596 |
| Flash point |
147.4°C |
| Vapour Pressur |
1.25E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
