ChemNet > CAS > 33401-74-0 (S)-(-)-ethyl-3-hydroxy 3-phenylpropionate
33401-74-0 (S)-(-)-ethyl-3-hydroxy 3-phenylpropionate
| product Name |
(S)-(-)-ethyl-3-hydroxy 3-phenylpropionate |
| Synonyms |
(-)-Ethyl (S)-3-hydroxy-3-phenylpropionate; (S)-Ethyl 3-Hydroxy-3-phenylpropanoate; ethyl (3S)-3-hydroxy-3-phenylpropanoate; Ethyl(S)-(-)-3-hydroxy-3-phenylpropionate |
| Molecular Formula |
C11H14O3 |
| Molecular Weight |
194.2271 |
| InChI |
InChI=1/C11H14O3/c1-2-14-11(13)8-10(12)9-6-4-3-5-7-9/h3-7,10,12H,2,8H2,1H3/t10-/m0/s1 |
| CAS Registry Number |
33401-74-0 |
| EINECS |
222-269-5 |
| Molecular Structure |
|
| Density |
1.119g/cm3 |
| Boiling point |
315.3°C at 760 mmHg |
| Refractive index |
1.523 |
| Flash point |
132.6°C |
| Vapour Pressur |
0.000186mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
