ChemNet > CAS > 3345-50-4 N-Carbamoylmaleiimide
3345-50-4 N-Carbamoylmaleiimide
| product Name |
N-Carbamoylmaleiimide |
| Synonyms |
N-Carbamoylmaleimide; 2,5-Dioxo-3-pyrroline-1-carboxamide~1H-Pyrrole-2,5-dione-1-carboxamide; 2,5-dioxo-2,5-dihydro-1H-pyrrole-1-carboxamide |
| Molecular Formula |
C5H4N2O3 |
| Molecular Weight |
140.0969 |
| InChI |
InChI=1/C5H4N2O3/c6-5(10)7-3(8)1-2-4(7)9/h1-2H,(H2,6,10) |
| CAS Registry Number |
3345-50-4 |
| EINECS |
222-097-0 |
| Molecular Structure |
|
| Density |
1.658g/cm3 |
| Boiling point |
307°C at 760 mmHg |
| Refractive index |
1.628 |
| Flash point |
139.5°C |
| Vapour Pressur |
0.000744mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
