ChemNet > CAS > 33924-48-0 Methyl 5-chloro-2-methoxybenzoate
33924-48-0 Methyl 5-chloro-2-methoxybenzoate
| product Name |
Methyl 5-chloro-2-methoxybenzoate |
| Synonyms |
5-Chloro-2-methoxybenzoic acid methyl ester; Methyl 5-chloro-o-anisate; 5-Chloro-o-anisic acid methyl ester (COOCH3=1); 5-Chloro-2-Methoxy Benzoic acid Methyl Ester |
| Molecular Formula |
C9H9ClO3 |
| Molecular Weight |
200.619 |
| InChI |
InChI=1/C9H9ClO3/c1-12-8-4-3-6(10)5-7(8)9(11)13-2/h3-5H,1-2H3 |
| CAS Registry Number |
33924-48-0 |
| EINECS |
251-743-4 |
| Molecular Structure |
|
| Density |
1.228g/cm3 |
| Boiling point |
237.5°C at 760 mmHg |
| Refractive index |
1.519 |
| Flash point |
120.2°C |
| Vapour Pressur |
0.0447mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
