ChemNet > CAS > 34158-72-0 2-Bromobenzaldehyde oxime
34158-72-0 2-Bromobenzaldehyde oxime
| product Name |
2-Bromobenzaldehyde oxime |
| Synonyms |
2-Bromobenzaldoxime |
| Molecular Formula |
C7H6BrNO |
| Molecular Weight |
200.0326 |
| InChI |
InChI=1/C7H6BrNO/c8-7-4-2-1-3-6(7)5-9-10/h1-5,10H/b9-5+ |
| CAS Registry Number |
34158-72-0 |
| Molecular Structure |
|
| Density |
1.52g/cm3 |
| Melting point |
102-104℃ |
| Boiling point |
265.6°C at 760 mmHg |
| Refractive index |
1.581 |
| Flash point |
114.4°C |
| Vapour Pressur |
0.00454mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
