ChemNet > CAS > 34420-17-2 2-Phenylethyl-1-boronic acid
34420-17-2 2-Phenylethyl-1-boronic acid
| product Name |
2-Phenylethyl-1-boronic acid |
| Synonyms |
Phenethylboronic acid; (2-phenylethyl)boronic acid; [(E)-2-phenylethenyl]boronic acid; 2-Phenylethaneboronic acid; Phenylethaneboronic Acid |
| Molecular Formula |
C8H9BO2 |
| Molecular Weight |
147.9669 |
| InChI |
InChI=1/C8H9BO2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7,10-11H/b7-6+ |
| CAS Registry Number |
34420-17-2 |
| Molecular Structure |
|
| Density |
1.13g/cm3 |
| Boiling point |
315.9°C at 760 mmHg |
| Refractive index |
1.587 |
| Flash point |
144.9°C |
| Vapour Pressur |
0.000179mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
