ChemNet > CAS > 34590-94-8 dipropylene glycol monomethyl ether, mixture of isomers
34590-94-8 dipropylene glycol monomethyl ether, mixture of isomers
| product Name |
dipropylene glycol monomethyl ether, mixture of isomers |
| Synonyms |
Di(propylene glycol) methyl ether; Methoxypropoxypropanol; Dipropylene glycol monomethyl ether; DPM |
| Molecular Formula |
C7H16O3 |
| Molecular Weight |
148.2001 |
| InChI |
InChI=1/C7H16O3/c1-3-7(8)10-6-4-5-9-2/h7-8H,3-6H2,1-2H3 |
| CAS Registry Number |
34590-94-8 |
| EINECS |
252-104-2 |
| Molecular Structure |
|
| Density |
0.958g/cm3 |
| Boiling point |
155.6°C at 760 mmHg |
| Refractive index |
1.423 |
| Flash point |
47.9°C |
| Vapour Pressur |
1.09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S23:;
S24/25:;
|
|
