ChemNet > CAS > 34803-68-4 1-(2-Pyrazinyl)-piperazine
34803-68-4 1-(2-Pyrazinyl)-piperazine
| product Name |
1-(2-Pyrazinyl)-piperazine |
| Synonyms |
1-(2-Pyrazinyl)piperazine; 2-piperazin-1-ylpyrazine; 4-pyrazin-2-ylpiperazin-1-ium |
| Molecular Formula |
C8H13N4 |
| Molecular Weight |
165.2151 |
| InChI |
InChI=1/C8H12N4/c1-2-11-8(7-10-1)12-5-3-9-4-6-12/h1-2,7,9H,3-6H2/p+1 |
| CAS Registry Number |
34803-68-4 |
| EINECS |
252-221-9 |
| Molecular Structure |
|
| Boiling point |
324.5°C at 760 mmHg |
| Flash point |
150°C |
| Vapour Pressur |
0.000245mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
