ChemNet > CAS > 35213-00-4 2,6-Dinitrobenzonitrile
35213-00-4 2,6-Dinitrobenzonitrile
| product Name |
2,6-Dinitrobenzonitrile |
| Synonyms |
Dinitrobenzonitrile; Benzonitrile, 2,6-dinitro-; 2,3-dinitrobenzonitrile |
| Molecular Formula |
C7H3N3O4 |
| Molecular Weight |
193.1164 |
| InChI |
InChI=1/C7H3N3O4/c8-4-5-2-1-3-6(9(11)12)7(5)10(13)14/h1-3H |
| CAS Registry Number |
35213-00-4 |
| Molecular Structure |
|
| Density |
1.555g/cm3 |
| Boiling point |
387.959°C at 760 mmHg |
| Refractive index |
1.616 |
| Flash point |
188.431°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
