ChemNet > CAS > 3558-69-8 2,6-Diphenylpyridine
3558-69-8 2,6-Diphenylpyridine
product Name |
2,6-Diphenylpyridine |
Synonyms |
Diphenylpyridine |
Molecular Formula |
C17H13N |
Molecular Weight |
231.2918 |
InChI |
InChI=1/C17H13N/c1-3-8-14(9-4-1)16-12-7-13-17(18-16)15-10-5-2-6-11-15/h1-13H |
CAS Registry Number |
3558-69-8 |
EINECS |
222-620-2 |
Molecular Structure |
|
Density |
1.084g/cm3 |
Melting point |
73-77℃ |
Boiling point |
397°C at 760 mmHg |
Refractive index |
1.605 |
Flash point |
166.4°C |
Vapour Pressur |
3.75E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|