CAS No: 35824-91-0, Chemical Name: 1,3-dicyclohexylpyrimidine-2,4,6(1H,3H,5H)-trione
the physical and chemical property of 35824-91-0, 1,3-dicyclohexylpyrimidine-2,4,6(1H,3H,5H)-trione is provided by ChemNet.com
ChemNet > CAS > 35824-91-0 1,3-dicyclohexylpyrimidine-2,4,6(1H,3H,5H)-trione
35824-91-0 1,3-dicyclohexylpyrimidine-2,4,6(1H,3H,5H)-trione
| product Name |
1,3-dicyclohexylpyrimidine-2,4,6(1H,3H,5H)-trione |
| Synonyms |
1,3-Dicyclohexylpyrimidine-2,4,6(1H,3H,5H)-trione; 2,4,6(1H,3H,5H)-pyrimidinetrione, 1,3-dicyclohexyl- |
| Molecular Formula |
C16H24N2O3 |
| Molecular Weight |
292.3734 |
| InChI |
InChI=1/C16H24N2O3/c19-14-11-15(20)18(13-9-5-2-6-10-13)16(21)17(14)12-7-3-1-4-8-12/h12-13H,1-11H2 |
| CAS Registry Number |
35824-91-0 |
| Molecular Structure |
|
| Density |
1.226g/cm3 |
| Boiling point |
413.8°C at 760 mmHg |
| Refractive index |
1.563 |
| Flash point |
172.9°C |
| Vapour Pressur |
4.68E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
