ChemNet > CAS > 3592-12-9 5,5-Dimethyl-1,3-dioxan-2-one
3592-12-9 5,5-Dimethyl-1,3-dioxan-2-one
| product Name |
5,5-Dimethyl-1,3-dioxan-2-one |
| Synonyms |
Neopentylene carbonate |
| Molecular Formula |
C6H10O3 |
| Molecular Weight |
130.1418 |
| InChI |
InChI=1/C6H10O3/c1-6(2)3-8-5(7)9-4-6/h3-4H2,1-2H3 |
| CAS Registry Number |
3592-12-9 |
| Molecular Structure |
|
| Density |
1.054g/cm3 |
| Boiling point |
231.5°C at 760 mmHg |
| Refractive index |
1.417 |
| Flash point |
114.5°C |
| Vapour Pressur |
0.062mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
