ChemNet > CAS > 3622-04-6 1,3-Benzothiazole-2-carboxylic acid
3622-04-6 1,3-Benzothiazole-2-carboxylic acid
product Name |
1,3-Benzothiazole-2-carboxylic acid |
Synonyms |
benzo[d]thiazole-2-carboxylic acid |
Molecular Formula |
C8H5NO2S |
Molecular Weight |
179.1958 |
InChI |
InChI=1/C8H5NO2S/c10-8(11)7-9-5-3-1-2-4-6(5)12-7/h1-4H,(H,10,11) |
CAS Registry Number |
3622-04-6 |
Molecular Structure |
|
Density |
1.508g/cm3 |
Melting point |
148℃ |
Boiling point |
378.5°C at 760 mmHg |
Refractive index |
1.731 |
Flash point |
182.7°C |
Vapour Pressur |
2.11E-06mmHg at 25°C |
Hazard Symbols |
Xn:Harmful;
|
Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|