ChemNet > CAS > 3853-91-6 Pentamethyliodobenzene
3853-91-6 Pentamethyliodobenzene
product Name |
Pentamethyliodobenzene |
Synonyms |
Iodopentamethylbenzene; 1-iodo-2,3,4,5,6-pentamethylbenzene |
Molecular Formula |
C11H15I |
Molecular Weight |
274.1413 |
InChI |
InChI=1/C11H15I/c1-6-7(2)9(4)11(12)10(5)8(6)3/h1-5H3 |
CAS Registry Number |
3853-91-6 |
EINECS |
223-360-2 |
Molecular Structure |
|
Density |
1.421g/cm3 |
Melting point |
135-137℃ |
Boiling point |
297.9°C at 760 mmHg |
Refractive index |
1.57 |
Flash point |
133.7°C |
Vapour Pressur |
0.00232mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|