ChemNet > CAS > 3853-91-6 Pentamethyliodobenzene
3853-91-6 Pentamethyliodobenzene
| product Name |
Pentamethyliodobenzene |
| Synonyms |
Iodopentamethylbenzene; 1-iodo-2,3,4,5,6-pentamethylbenzene |
| Molecular Formula |
C11H15I |
| Molecular Weight |
274.1413 |
| InChI |
InChI=1/C11H15I/c1-6-7(2)9(4)11(12)10(5)8(6)3/h1-5H3 |
| CAS Registry Number |
3853-91-6 |
| EINECS |
223-360-2 |
| Molecular Structure |
|
| Density |
1.421g/cm3 |
| Melting point |
135-137℃ |
| Boiling point |
297.9°C at 760 mmHg |
| Refractive index |
1.57 |
| Flash point |
133.7°C |
| Vapour Pressur |
0.00232mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
