ChemNet > CAS > 38594-42-2 Dichlorobenzylalcohol; 98%
38594-42-2 Dichlorobenzylalcohol; 98%
| product Name |
Dichlorobenzylalcohol; 98% |
| Synonyms |
2,3-Dichlorobenzyl alcohol; (2,3-dichlorophenyl)methanol |
| Molecular Formula |
C7H6Cl2O |
| Molecular Weight |
177.0279 |
| InChI |
InChI=1/C7H6Cl2O/c8-6-3-1-2-5(4-10)7(6)9/h1-3,10H,4H2 |
| CAS Registry Number |
38594-42-2 |
| Molecular Structure |
|
| Density |
1.392g/cm3 |
| Melting point |
85-88℃ |
| Boiling point |
271.2°C at 760 mmHg |
| Refractive index |
1.582 |
| Flash point |
115.8°C |
| Vapour Pressur |
0.00321mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
