ChemNet > CAS > 3878-55-5 mono-Methyl succinate
3878-55-5 mono-Methyl succinate
| product Name |
mono-Methyl succinate |
| Synonyms |
Succinic acid monomethyl ester; methyl hydrogen succinate; mono-Methyl hydrogen succinate; 4-Methoxy-4-oxobutanoic acid; 4-methoxy-4-oxobutanoate |
| Molecular Formula |
C5H7O4 |
| Molecular Weight |
131.1072 |
| InChI |
InChI=1/C5H8O4/c1-9-5(8)3-2-4(6)7/h2-3H2,1H3,(H,6,7)/p-1 |
| CAS Registry Number |
3878-55-5 |
| EINECS |
223-408-2 |
| Molecular Structure |
|
| Melting point |
55-59℃ |
| Boiling point |
259.2°C at 760 mmHg |
| Flash point |
104.5°C |
| Vapour Pressur |
0.00394mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
