ChemNet > CAS > 388088-73-1 (6-morpholino-3-pyridinyl)methanol
388088-73-1 (6-morpholino-3-pyridinyl)methanol
| product Name |
(6-morpholino-3-pyridinyl)methanol |
| Synonyms |
(6-morpholin-4-ylpyridin-3-yl)methanol |
| Molecular Formula |
C10H14N2O2 |
| Molecular Weight |
194.2304 |
| InChI |
InChI=1/C10H14N2O2/c13-8-9-1-2-10(11-7-9)12-3-5-14-6-4-12/h1-2,7,13H,3-6,8H2 |
| CAS Registry Number |
388088-73-1 |
| Molecular Structure |
|
| Density |
1.215g/cm3 |
| Boiling point |
414.1°C at 760 mmHg |
| Refractive index |
1.572 |
| Flash point |
204.3°C |
| Vapour Pressur |
1.34E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
