ChemNet > CAS > 394-28-5 2-Bromo-5-Fluorobenzoic Acid
394-28-5 2-Bromo-5-Fluorobenzoic Acid
| product Name |
2-Bromo-5-Fluorobenzoic Acid |
| Synonyms |
2-Bromo-5-fluorobenzoic acid,98%; 2-bromo-5-fluorobenzoicacid,98%; RARECHEM AL BO 0747; BUTTPARK 19\01-66; 2-Bromo-5-Fluorobenzoic; 2-Bromo-5-fluorobenzoic acid 98%; 2-bromo-5-fluorobenzoate |
| Molecular Formula |
C7H3BrFO2 |
| Molecular Weight |
218.0005 |
| InChI |
InChI=1/C7H4BrFO2/c8-6-2-1-4(9)3-5(6)7(10)11/h1-3H,(H,10,11)/p-1 |
| CAS Registry Number |
394-28-5 |
| Molecular Structure |
|
| Melting point |
154-157℃ |
| Boiling point |
291.1°C at 760 mmHg |
| Flash point |
129.8°C |
| Vapour Pressur |
0.000915mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
