ChemNet > CAS > 403-15-6 4-Fluoro-3-methylbenzoic acid
403-15-6 4-Fluoro-3-methylbenzoic acid
| product Name |
4-Fluoro-3-methylbenzoic acid |
| Synonyms |
4-Fluoro-m-toluic acid; 4-fluoro-3-methylbenzoate; 3-methyl-4-Fluorobenzoic acid;
|
| Molecular Formula |
C8H6FO2 |
| Molecular Weight |
153.131 |
| InChI |
InChI=1/C8H7FO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,1H3,(H,10,11)/p-1 |
| CAS Registry Number |
403-15-6 |
| Molecular Structure |
|
| Melting point |
166-169℃ |
| Boiling point |
266.3°C at 760 mmHg |
| Flash point |
114.9°C |
| Vapour Pressur |
0.00434mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
