ChemNet > CAS > 4110-50-3 Ethyl n-propyl sulfide
4110-50-3 Ethyl n-propyl sulfide
| product Name |
Ethyl n-propyl sulfide |
| Synonyms |
Ethyl n-propyl sulphide; 1-(ethylsulfanyl)propane; 3-(chloromethyl)-1,2,4,5-tetramethylbenzene; Ethyl propyl sulfide |
| Molecular Formula |
C11H15Cl |
| Molecular Weight |
182.6898 |
| InChI |
InChI=1/C11H15Cl/c1-7-5-8(2)10(4)11(6-12)9(7)3/h5H,6H2,1-4H3 |
| CAS Registry Number |
4110-50-3 |
| EINECS |
223-890-4 |
| Molecular Structure |
|
| Density |
1.002g/cm3 |
| Boiling point |
269.4°C at 760 mmHg |
| Refractive index |
1.519 |
| Flash point |
113.8°C |
| Vapour Pressur |
0.012mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
