ChemNet > CAS > 4124-30-5 Dichloroacetic anhydride
4124-30-5 Dichloroacetic anhydride
| product Name |
Dichloroacetic anhydride |
| Synonyms |
Acetic acid, 2,2-dichloro-, 1,1'-anhydride; 4-02-00-00503 (Beilstein Handbook Reference); Anhydrid kyseliny dichloroctove; Anhydrid kyseliny dichloroctove [Czech]; BRN 0512173; Dichloroacetic acid anhydride; NSC 401832; 2,2'-Dichloroacetic anhydride; Acetic acid, dichloro-, anhydride |
| Molecular Formula |
C4H2Cl4O3 |
| Molecular Weight |
239.8689 |
| InChI |
InChI=1/C4H2Cl4O3/c5-1(6)3(9)11-4(10)2(7)8/h1-2H |
| CAS Registry Number |
4124-30-5 |
| EINECS |
223-924-8 |
| Molecular Structure |
|
| Density |
1.695g/cm3 |
| Melting point |
29℃ |
| Boiling point |
215°C at 760 mmHg |
| Refractive index |
1.501 |
| Flash point |
90.6°C |
| Vapour Pressur |
0.151mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R21:Harmful in contact with skin.;
R34:Causes burns.;
|
| Safety Description |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
