ChemNet > CAS > 41361-28-8 1-Ethyl-3-piperidone hydrochloride
41361-28-8 1-Ethyl-3-piperidone hydrochloride
| product Name |
1-Ethyl-3-piperidone hydrochloride |
| Synonyms |
1-ethylpiperidin-3-one hydrochloride; 1-ethylpiperidin-3-one; 1-ethyl-3-oxopiperidinium |
| Molecular Formula |
C7H14NO |
| Molecular Weight |
128.1916 |
| InChI |
InChI=1/C7H13NO/c1-2-8-5-3-4-7(9)6-8/h2-6H2,1H3/p+1 |
| CAS Registry Number |
41361-28-8 |
| EINECS |
255-333-6 |
| Molecular Structure |
|
| Melting point |
178-180℃ |
| Boiling point |
186.8°C at 760 mmHg |
| Flash point |
61.6°C |
| Vapour Pressur |
0.651mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
