ChemNet > CAS > 4160-51-4 4'-methoxybutyrophenone
4160-51-4 4'-methoxybutyrophenone
| product Name |
4'-methoxybutyrophenone |
| Synonyms |
1-(4-Methoxyphenyl)butan-1-on; 1-(4-Methoxyphenyl)butan-1-one; 1-Butanone, 1- (4-methoxyphenyl)-; 1-butanone, 1-(4-methoxyphenyl)-; 4'-Methoxy-butyrophenone; 4-Methoxybutyrophenone; Butyrophenone, 4'-methoxy-; p-Methoxybutyrophenone; 4-Butyrylanisole |
| Molecular Formula |
C11H14O2 |
| Molecular Weight |
178.2277 |
| InChI |
InChI=1/C11H14O2/c1-3-4-11(12)9-5-7-10(13-2)8-6-9/h5-8H,3-4H2,1-2H3 |
| CAS Registry Number |
4160-51-4 |
| EINECS |
223-995-5 |
| Molecular Structure |
|
| Density |
1.001g/cm3 |
| Boiling point |
288.3°C at 760 mmHg |
| Refractive index |
1.498 |
| Flash point |
124.3°C |
| Vapour Pressur |
0.00236mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
