ChemNet > CAS > 41667-95-2 5,6-dichloronicotinic acid
41667-95-2 5,6-dichloronicotinic acid
| product Name |
5,6-dichloronicotinic acid |
| Synonyms |
5,6-Dichloropyridine-3-carboxylic acid; 5,6-dichloro nicotinic acid |
| Molecular Formula |
C6H3Cl2NO2 |
| Molecular Weight |
191.9995 |
| InChI |
InChI=1/C6H3Cl2NO2/c7-4-1-3(6(10)11)2-9-5(4)8/h1-2H,(H,10,11) |
| CAS Registry Number |
41667-95-2 |
| Molecular Structure |
|
| Density |
1.612g/cm3 |
| Melting point |
164-168℃ |
| Boiling point |
342.1°C at 760 mmHg |
| Refractive index |
1.605 |
| Flash point |
160.7°C |
| Vapour Pressur |
2.96E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S22:;
S24/25:;
|
|
