ChemNet > CAS > 42340-98-7 R(-)-1-(1-naphthyl)ethyl isocyanate stab.
42340-98-7 R(-)-1-(1-naphthyl)ethyl isocyanate stab.
| product Name |
R(-)-1-(1-naphthyl)ethyl isocyanate stab. |
| Synonyms |
(R)-(-)-1-(1-Naphthyl)ethyl isocyanate; Isocyanic acid (R)-(-)-1-(1-naphthyl)ethyl ester; 1-[(1R)-1-isocyanatoethyl]naphthalene |
| Molecular Formula |
C13H11NO |
| Molecular Weight |
197.2325 |
| InChI |
InChI=1/C13H11NO/c1-10(14-9-15)12-8-4-6-11-5-2-3-7-13(11)12/h2-8,10H,1H3/t10-/m1/s1 |
| CAS Registry Number |
42340-98-7 |
| EINECS |
255-759-2 |
| Molecular Structure |
|
| Density |
1.06g/cm3 |
| Boiling point |
333.5°C at 760 mmHg |
| Refractive index |
1.57 |
| Flash point |
93.3°C |
| Vapour Pressur |
0.000136mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
