ChemNet > CAS > 4247-02-3 isobutyl 4-hydroxybenzoate
4247-02-3 isobutyl 4-hydroxybenzoate
| product Name |
isobutyl 4-hydroxybenzoate |
| Synonyms |
4-Hydroxybenzoic acid isobutyl ester; Isobutyl paraben; 2-Methylpropyl 4-hydroxybenzoate; iso-Butyl Paraben; Isobutyl-P-Hydroxybenzoate; iso-Butyl p-Hydroxybenzoate |
| Molecular Formula |
C11H14O3 |
| Molecular Weight |
194.2271 |
| InChI |
InChI=1/C11H14O3/c1-8(2)7-14-11(13)9-3-5-10(12)6-4-9/h3-6,8,12H,7H2,1-2H3 |
| CAS Registry Number |
4247-02-3 |
| EINECS |
224-208-8 |
| Molecular Structure |
|
| Density |
1.105g/cm3 |
| Boiling point |
302.3°C at 760 mmHg |
| Refractive index |
1.524 |
| Flash point |
125.4°C |
| Vapour Pressur |
0.000556mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
