ChemNet > CAS > 43088-42-2 Ethyl 2-amino-4-methylthiophene-3-carboxylate
43088-42-2 Ethyl 2-amino-4-methylthiophene-3-carboxylate
product Name |
Ethyl 2-amino-4-methylthiophene-3-carboxylate |
Synonyms |
2-Amino-4-methylthiophene-3-carboxylic acid ethyl ester |
Molecular Formula |
C8H11NO2S |
Molecular Weight |
185.2434 |
InChI |
InChI=1/C8H11NO2S/c1-3-11-8(10)6-5(2)4-12-7(6)9/h4H,3,9H2,1-2H3 |
CAS Registry Number |
43088-42-2 |
Molecular Structure |
|
Density |
1.219g/cm3 |
Melting point |
72℃ |
Boiling point |
279.1°C at 760 mmHg |
Refractive index |
1.573 |
Flash point |
122.6°C |
Vapour Pressur |
0.00411mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|