ChemNet > CAS > 4433-30-1 Undecanophenone
4433-30-1 Undecanophenone
product Name |
Undecanophenone |
Synonyms |
n-Decyl phenyl ketone; 1-phenylundecan-2-one |
Molecular Formula |
C17H26O |
Molecular Weight |
246.3877 |
InChI |
InChI=1/C17H26O/c1-2-3-4-5-6-7-11-14-17(18)15-16-12-9-8-10-13-16/h8-10,12-13H,2-7,11,14-15H2,1H3 |
CAS Registry Number |
4433-30-1 |
EINECS |
224-633-9 |
Molecular Structure |
|
Density |
0.92g/cm3 |
Melting point |
28-30℃ |
Boiling point |
342.846°C at 760 mmHg |
Refractive index |
1.49 |
Flash point |
114.968°C |
Vapour Pressur |
0mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|