ChemNet > CAS > 446-24-2 2-Fluorobenzoic hydrazide
446-24-2 2-Fluorobenzoic hydrazide
| product Name |
2-Fluorobenzoic hydrazide |
| Synonyms |
2-Fluorobenzhydrazide; 2-fluorobenzohydrazide |
| Molecular Formula |
C7H7FN2O |
| Molecular Weight |
154.1417 |
| InChI |
InChI=1/C7H7FN2O/c8-6-4-2-1-3-5(6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| CAS Registry Number |
446-24-2 |
| Molecular Structure |
|
| Density |
1.272g/cm3 |
| Melting point |
70-74℃ |
| Boiling point |
309.1°C at 760 mmHg |
| Refractive index |
1.552 |
| Flash point |
140.7°C |
| Vapour Pressur |
0.000282mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
