ChemNet > CAS > 4534-74-1 4-Ethylcyclohexanol
4534-74-1 4-Ethylcyclohexanol
product Name |
4-Ethylcyclohexanol |
Synonyms |
Ethylcyclohexanol; 4-Ethylcyclohexanol, mixture of cis- and trans isomers; Ethyl cyclohexanol |
Molecular Formula |
C8H16O |
Molecular Weight |
128.21 |
InChI |
InChI=1/C8H16O/c1-2-7-3-5-8(9)6-4-7/h7-9H,2-6H2,1H3 |
CAS Registry Number |
4534-74-1 |
EINECS |
224-878-1 |
Molecular Structure |
|
Density |
0.889 |
Boiling point |
83.4-84.4℃ (10 mmHg) |
Refractive index |
1.461-1.463 |
Flash point |
77℃ |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:;
|
|