ChemNet > CAS > 477-75-8 Triptycene
477-75-8 Triptycene
product Name |
Triptycene |
Synonyms |
9,10-o-Benzeno-9,10-dihydroanthracene; pentacyclo[6.6.6.0~2,7~.0~9,14~.0~15,20~]icosa-2,4,6,9,11,13,15,17,19-nonaene (non-preferred name) |
Molecular Formula |
C20H14 |
Molecular Weight |
254.3252 |
InChI |
InChI=1/C20H14/c1-2-8-14-13(7-1)19-15-9-3-5-11-17(15)20(14)18-12-6-4-10-16(18)19/h1-12,19-20H |
CAS Registry Number |
477-75-8 |
EINECS |
207-519-3 |
Molecular Structure |
|
Density |
1.197g/cm3 |
Melting point |
252-256℃ |
Boiling point |
371.8°C at 760 mmHg |
Refractive index |
1.688 |
Flash point |
171.7°C |
Vapour Pressur |
2.15E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|