ChemNet > CAS > 486-70-4 lupinine
486-70-4 lupinine
| product Name |
lupinine |
| Synonyms |
(-)-Lupinine; (1R-trans)-Octahydro-2H-quinolizine-1-methanol; (1R,9aR)-octahydro-2H-quinolizin-1-ylmethanol; (1S,9aR)-octahydro-2H-quinolizin-1-ylmethanol |
| Molecular Formula |
C10H19NO |
| Molecular Weight |
169.264 |
| InChI |
InChI=1/C10H19NO/c12-8-9-4-3-7-11-6-2-1-5-10(9)11/h9-10,12H,1-8H2/t9-,10-/m1/s1 |
| CAS Registry Number |
486-70-4 |
| EINECS |
207-638-0 |
| Molecular Structure |
|
| Density |
1.04g/cm3 |
| Melting point |
68-69℃ |
| Boiling point |
270°C at 760 mmHg |
| Refractive index |
1.525 |
| Flash point |
99.1°C |
| Vapour Pressur |
0.000928mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
