ChemNet > CAS > 4906-24-5 3-Acetoxy-2-butanone
4906-24-5 3-Acetoxy-2-butanone
| product Name |
3-Acetoxy-2-butanone |
| Synonyms |
Acetoin acetate; 3-oxobutan-2-yl acetate; 2-Acetoxy-3-butanone |
| Molecular Formula |
C6H10O3 |
| Molecular Weight |
130.1418 |
| InChI |
InChI=1/C6H10O3/c1-4(7)5(2)9-6(3)8/h5H,1-3H3 |
| CAS Registry Number |
4906-24-5 |
| Molecular Structure |
|
| Density |
1.012g/cm3 |
| Boiling point |
163.4°C at 760 mmHg |
| Refractive index |
1.406 |
| Flash point |
56.6°C |
| Vapour Pressur |
2.07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
