ChemNet > CAS > 499769-96-9 1,3-Benzothiazol-2-ylboronic acid
499769-96-9 1,3-Benzothiazol-2-ylboronic acid
| product Name |
1,3-Benzothiazol-2-ylboronic acid |
| Synonyms |
1,3-Benzothiazol-2-Ylboronic Acid,97% |
| Molecular Formula |
C7H6BNO2S |
| Molecular Weight |
179.004 |
| InChI |
InChI=1/C7H6BNO2S/c10-8(11)7-9-5-3-1-2-4-6(5)12-7/h1-4,10-11H |
| CAS Registry Number |
499769-96-9 |
| Molecular Structure |
|
| Density |
1.441g/cm3 |
| Melting point |
163.6℃ |
| Boiling point |
388.033°C at 760 mmHg |
| Refractive index |
1.677 |
| Flash point |
188.476°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
