ChemNet > CAS > 513-85-9;123513-85-9 butane-2,3-diol
513-85-9;123513-85-9 butane-2,3-diol
| product Name |
butane-2,3-diol |
| Synonyms |
2,3-Butanediol; 2,3-Dihydroxybutane; 2,3-Butanediol, mixture of DL and meso; 2,3-butylene glycol; (2R,3S)-butane-2,3-diol |
| Molecular Formula |
C4H10O2 |
| Molecular Weight |
90.121 |
| InChI |
InChI=1/C4H10O2/c1-3(5)4(2)6/h3-6H,1-2H3 |
| CAS Registry Number |
513-85-9;123513-85-9 |
| EINECS |
208-173-6 |
| Molecular Structure |
|
| Density |
0.997g/cm3 |
| Melting point |
25℃ |
| Boiling point |
180.7°C at 760 mmHg |
| Refractive index |
1.434 |
| Flash point |
85°C |
| Water solubility |
SOLUBLE |
| Vapour Pressur |
0.26mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:;
|
|
