ChemNet > CAS > 527-17-3 Duroquinone
527-17-3 Duroquinone
product Name |
Duroquinone |
Molecular Formula |
C10H12O2 |
Molecular Weight |
164.2011 |
InChI |
InChI=1/C10H12O2/c1-5-6(2)10(12)8(4)7(3)9(5)11/h1-4H3 |
CAS Registry Number |
527-17-3 |
EINECS |
208-409-8 |
Molecular Structure |
|
Density |
1.039g/cm3 |
Melting point |
109-114℃ |
Boiling point |
230.1°C at 760 mmHg |
Refractive index |
1.493 |
Flash point |
83.6°C |
Vapour Pressur |
0.0672mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|