ChemNet > CAS > 527-17-3 Duroquinone
527-17-3 Duroquinone
| product Name |
Duroquinone |
| Molecular Formula |
C10H12O2 |
| Molecular Weight |
164.2011 |
| InChI |
InChI=1/C10H12O2/c1-5-6(2)10(12)8(4)7(3)9(5)11/h1-4H3 |
| CAS Registry Number |
527-17-3 |
| EINECS |
208-409-8 |
| Molecular Structure |
|
| Density |
1.039g/cm3 |
| Melting point |
109-114℃ |
| Boiling point |
230.1°C at 760 mmHg |
| Refractive index |
1.493 |
| Flash point |
83.6°C |
| Vapour Pressur |
0.0672mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
