ChemNet > CAS > 527-52-6 D(+)-Digitoxose
527-52-6 D(+)-Digitoxose
product Name |
D(+)-Digitoxose |
Synonyms |
2,6-Dideoxy-D-ribohexose; Digitoxose; 2,6-dideoxy-D-ribo-hexopyranose; 2,6-dideoxy-alpha-D-ribo-hexopyranose; 2,6-dideoxy-beta-D-ribo-hexopyranose |
Molecular Formula |
C6H12O4 |
Molecular Weight |
148.1571 |
InChI |
InChI=1/C6H12O4/c1-3-6(9)4(7)2-5(8)10-3/h3-9H,2H2,1H3/t3-,4+,5-,6-/m1/s1 |
CAS Registry Number |
527-52-6 |
EINECS |
208-416-6 |
Molecular Structure |
|
Density |
1.366g/cm3 |
Melting point |
112-100℃ |
Boiling point |
320.1°C at 760 mmHg |
Refractive index |
1.542 |
Flash point |
147.4°C |
Vapour Pressur |
2.64E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|